C34H50N4O7 — CID 163972270
2-phenoxyethyl N-[(1S)-1-cyclohexyl-2-[(2S,3R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 163972270) has the molecular formula C34H50N4O7 and a molecular weight of 626.80 g/mol. Its IUPAC name is 2-phenoxyethyl N-[(1S)-1-cyclohexyl-2-[(2S,3R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | 2-phenoxyethyl N-[(1S)-1-cyclohexyl-2-[(2S,3R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 163972270 |
| Molecular Formula | C34H50N4O7 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.37 |
| IUPAC Name | 2-phenoxyethyl N-[(1S)-1-cyclohexyl-2-[(2S,3R)-2-[[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)[C@@H]1[C@@H](C(C)C)CCN1C(=O)[C@@H](NC(=O)OCCOc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C34H50N4O7/c1-5-13-27(30(39)32(41)35-19-6-2)36-31(40)29-26(23(3)4)18-20-38(29)33(42)28(24-14-9-7-10-15-24)37-34(43)45-22-21-44-25-16-11-8-12-17-25/h6,8,11-12,16-17,23-24,26-29H,2,5,7,9-10,13-15,18-22H2,1,3-4H3,(H,35,41)(H,36,40)(H,37,43)/t26-,27?,28+,29+/m1/s1 |
| InChIKey | SRALYVIKQWKBJG-POQGNYHUSA-N |
| XLogP | 3.77 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|