C41H61N5O9 — CID 21017593
tert-butyl 2-[[2-[[3-[[1-[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]-3-prop-2-enylpyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate (PubChem CID 21017593) has the molecular formula C41H61N5O9 and a molecular weight of 767.97 g/mol. Its IUPAC name is tert-butyl 2-[[2-[[3-[[1-[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]-3-prop-2-enylpyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate.
| Compound Name | tert-butyl 2-[[2-[[3-[[1-[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]-3-prop-2-enylpyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 21017593 |
| Molecular Formula | C41H61N5O9 |
| Molecular Weight | 767.97 g/mol |
| Exact Mass | 767.45 |
| IUPAC Name | tert-butyl 2-[[2-[[3-[[1-[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]-3-prop-2-enylpyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate |
| SMILES | C=CCC1CCN(C(=O)C(NC(=O)OCC(C)C)C2CCCCC2)C1C(=O)NC(CCC)C(=O)C(=O)NCC(=O)NC(C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C41H61N5O9/c1-8-16-29-22-23-46(38(51)32(27-18-12-10-13-19-27)45-40(53)54-25-26(3)4)34(29)36(49)43-30(17-9-2)35(48)37(50)42-24-31(47)44-33(28-20-14-11-15-21-28)39(52)55-41(5,6)7/h8,11,14-15,20-21,26-27,29-30,32-34H,1,9-10,12-13,16-19,22-25H2,2-7H3,(H,42,50)(H,43,49)(H,44,47)(H,45,53) |
| InChIKey | BTSINISSXCGJRZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 189.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.97 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|