C38H57N5O10 — CID 58785965
tert-butyl 2-[[2-[[3-[[2-[[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]-3-(oxiran-2-yl)propanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate (PubChem CID 58785965) has the molecular formula C38H57N5O10 and a molecular weight of 743.90 g/mol. Its IUPAC name is tert-butyl 2-[[2-[[3-[[2-[[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]-3-(oxiran-2-yl)propanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate.
| Compound Name | tert-butyl 2-[[2-[[3-[[2-[[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]-3-(oxiran-2-yl)propanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 58785965 |
| Molecular Formula | C38H57N5O10 |
| Molecular Weight | 743.90 g/mol |
| Exact Mass | 743.41 |
| IUPAC Name | tert-butyl 2-[[2-[[3-[[2-[[2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]-3-(oxiran-2-yl)propanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate |
| SMILES | CCCC(NC(=O)C(CC1CO1)NC(=O)C(NC(=O)OCC(C)C)C1CCCCC1)C(=O)C(=O)NCC(=O)NC(C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C38H57N5O10/c1-7-14-27(32(45)35(48)39-20-29(44)42-31(25-17-12-9-13-18-25)36(49)53-38(4,5)6)40-33(46)28(19-26-22-51-26)41-34(47)30(24-15-10-8-11-16-24)43-37(50)52-21-23(2)3/h9,12-13,17-18,23-24,26-28,30-31H,7-8,10-11,14-16,19-22H2,1-6H3,(H,39,48)(H,40,46)(H,41,47)(H,42,44)(H,43,50) |
| InChIKey | LBFFKDKVFHOSIH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 210.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.90 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|