C32H53N5O9 — CID 89390569
(2S)-2-[[2-[[3-[[(2S)-2-[[(2S)-2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]-4-methylpentanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]pent-4-enoic acid (PubChem CID 89390569) has the molecular formula C32H53N5O9 and a molecular weight of 651.80 g/mol. Its IUPAC name is (2S)-2-[[2-[[3-[[(2S)-2-[[(2S)-2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]-4-methylpentanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]pent-4-enoic acid.
| Compound Name | (2S)-2-[[2-[[3-[[(2S)-2-[[(2S)-2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]-4-methylpentanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 89390569 |
| Molecular Formula | C32H53N5O9 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.38 |
| IUPAC Name | (2S)-2-[[2-[[3-[[(2S)-2-[[(2S)-2-cyclohexyl-2-(2-methylpropoxycarbonylamino)acetyl]amino]-4-methylpentanoyl]amino]-2-oxohexanoyl]amino]acetyl]amino]pent-4-enoic acid |
| SMILES | C=CC[C@H](NC(=O)CNC(=O)C(=O)C(CCC)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCC(C)C)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C32H53N5O9/c1-7-12-22(27(39)30(42)33-17-25(38)34-23(13-8-2)31(43)44)35-28(40)24(16-19(3)4)36-29(41)26(21-14-10-9-11-15-21)37-32(45)46-18-20(5)6/h8,19-24,26H,2,7,9-18H2,1,3-6H3,(H,33,42)(H,34,38)(H,35,40)(H,36,41)(H,37,45)(H,43,44)/t22?,23-,24-,26-/m0/s1 |
| InChIKey | AKFQPXAHRUVSKS-JXXSUMLHSA-N |
| XLogP | 1.96 |
| TPSA | 209.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|