C19H25N — CID 14883833
3-ethyl-4-(6-phenylhexan-3-yl)pyridine (PubChem CID 14883833) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 3-ethyl-4-(6-phenylhexan-3-yl)pyridine.
| Compound Name | 3-ethyl-4-(6-phenylhexan-3-yl)pyridine |
|---|---|
| PubChem CID | 14883833 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 3-ethyl-4-(6-phenylhexan-3-yl)pyridine |
| SMILES | CCc1cnccc1C(CC)CCCc1ccccc1 |
| InChI | InChI=1S/C19H25N/c1-3-17(19-13-14-20-15-18(19)4-2)12-8-11-16-9-6-5-7-10-16/h5-7,9-10,13-15,17H,3-4,8,11-12H2,1-2H3 |
| InChIKey | IDCVRUMMOIZROT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |