C24H31N3O6S — CID 148845023
4-[2-[1-[(2-nitrophenyl)sulfonylamino]cyclopentyl]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 148845023) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is 4-[2-[1-[(2-nitrophenyl)sulfonylamino]cyclopentyl]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | 4-[2-[1-[(2-nitrophenyl)sulfonylamino]cyclopentyl]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 148845023 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 4-[2-[1-[(2-nitrophenyl)sulfonylamino]cyclopentyl]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | NC(=O)C12CC3CC(C1)C(CC(=O)C1(NS(=O)(=O)c4ccccc4[N+](=O)[O-])CCCC1)C(C3)C2 |
| InChI | InChI=1S/C24H31N3O6S/c25-22(29)23-12-15-9-16(13-23)18(17(10-15)14-23)11-21(28)24(7-3-4-8-24)26-34(32,33)20-6-2-1-5-19(20)27(30)31/h1-2,5-6,15-18,26H,3-4,7-14H2,(H2,25,29) |
| InChIKey | OWHGLZFZYFQRLI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|