C28H16F4N2O3S — CID 148862664
[4-fluoro-2-(3-phenylphenanthro[9,10-d]imidazol-2-yl)phenyl] trifluoromethanesulfonate (PubChem CID 148862664) has the molecular formula C28H16F4N2O3S and a molecular weight of 536.51 g/mol. Its IUPAC name is [4-fluoro-2-(3-phenylphenanthro[9,10-d]imidazol-2-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-fluoro-2-(3-phenylphenanthro[9,10-d]imidazol-2-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 148862664 |
| Molecular Formula | C28H16F4N2O3S |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | [4-fluoro-2-(3-phenylphenanthro[9,10-d]imidazol-2-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(F)cc1-c1nc2c3ccccc3c3ccccc3c2n1-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H16F4N2O3S/c29-17-14-15-24(37-38(35,36)28(30,31)32)23(16-17)27-33-25-21-12-6-4-10-19(21)20-11-5-7-13-22(20)26(25)34(27)18-8-2-1-3-9-18/h1-16H |
| InChIKey | OZQDXLPHRUJGBE-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|