C20H39NO2S — CID 148869237
(S)-[4-[(2R)-butan-2-yl]cyclohex-3-en-1-yl]methoxy-[3-(2-methylbutan-2-ylsulfanyl)propylamino]methanol (PubChem CID 148869237) has the molecular formula C20H39NO2S and a molecular weight of 357.60 g/mol. Its IUPAC name is (S)-[4-[(2R)-butan-2-yl]cyclohex-3-en-1-yl]methoxy-[3-(2-methylbutan-2-ylsulfanyl)propylamino]methanol.
| Compound Name | (S)-[4-[(2R)-butan-2-yl]cyclohex-3-en-1-yl]methoxy-[3-(2-methylbutan-2-ylsulfanyl)propylamino]methanol |
|---|---|
| PubChem CID | 148869237 |
| Molecular Formula | C20H39NO2S |
| Molecular Weight | 357.60 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (S)-[4-[(2R)-butan-2-yl]cyclohex-3-en-1-yl]methoxy-[3-(2-methylbutan-2-ylsulfanyl)propylamino]methanol |
| SMILES | CC[C@@H](C)C1=CCC(CO[C@H](O)NCCCSC(C)(C)CC)CC1 |
| InChI | InChI=1S/C20H39NO2S/c1-6-16(3)18-11-9-17(10-12-18)15-23-19(22)21-13-8-14-24-20(4,5)7-2/h11,16-17,19,21-22H,6-10,12-15H2,1-5H3/t16-,17?,19+/m1/s1 |
| InChIKey | PAVLZBRZJZZIGB-HHBDYARMSA-N |
| XLogP | 4.95 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|