C18H22FN3O3 — CID 148877479
tert-butyl 2-[4-[[3-amino-2-(methylamino)-4-pyridinyl]oxy]-2-fluorophenyl]acetate (PubChem CID 148877479) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is tert-butyl 2-[4-[[3-amino-2-(methylamino)-4-pyridinyl]oxy]-2-fluorophenyl]acetate.
| Compound Name | tert-butyl 2-[4-[[3-amino-2-(methylamino)-4-pyridinyl]oxy]-2-fluorophenyl]acetate |
|---|---|
| PubChem CID | 148877479 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | tert-butyl 2-[4-[[3-amino-2-(methylamino)-4-pyridinyl]oxy]-2-fluorophenyl]acetate |
| SMILES | CNc1nccc(Oc2ccc(CC(=O)OC(C)(C)C)c(F)c2)c1N |
| InChI | InChI=1S/C18H22FN3O3/c1-18(2,3)25-15(23)9-11-5-6-12(10-13(11)19)24-14-7-8-22-17(21-4)16(14)20/h5-8,10H,9,20H2,1-4H3,(H,21,22) |
| InChIKey | PCJWOJSHINQQRC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |