C21H21ClN2O4 — CID 87869429
tert-butyl 2-[4-[(7-chloro-1,6-naphthyridin-4-yl)oxy]-2-methoxyphenyl]acetate (PubChem CID 87869429) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is tert-butyl 2-[4-[(7-chloro-1,6-naphthyridin-4-yl)oxy]-2-methoxyphenyl]acetate.
| Compound Name | tert-butyl 2-[4-[(7-chloro-1,6-naphthyridin-4-yl)oxy]-2-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 87869429 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | tert-butyl 2-[4-[(7-chloro-1,6-naphthyridin-4-yl)oxy]-2-methoxyphenyl]acetate |
| SMILES | COc1cc(Oc2ccnc3cc(Cl)ncc23)ccc1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H21ClN2O4/c1-21(2,3)28-20(25)9-13-5-6-14(10-18(13)26-4)27-17-7-8-23-16-11-19(22)24-12-15(16)17/h5-8,10-12H,9H2,1-4H3 |
| InChIKey | HZNZTRUIZTXHIV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|