C21H20O8 — CID 14888575
(5R,6R,7S)-7-hydroxy-5-(4-hydroxy-3,5-dimethoxyphenyl)spiro[5,7-dihydrocyclopenta[f][1,3]benzodioxole-6,3'-oxolane]-2'-one (PubChem CID 14888575) has the molecular formula C21H20O8 and a molecular weight of 400.38 g/mol. Its IUPAC name is (5R,6R,7S)-7-hydroxy-5-(4-hydroxy-3,5-dimethoxyphenyl)spiro[5,7-dihydrocyclopenta[f][1,3]benzodioxole-6,3'-oxolane]-2'-one.
| Compound Name | (5R,6R,7S)-7-hydroxy-5-(4-hydroxy-3,5-dimethoxyphenyl)spiro[5,7-dihydrocyclopenta[f][1,3]benzodioxole-6,3'-oxolane]-2'-one |
|---|---|
| PubChem CID | 14888575 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (5R,6R,7S)-7-hydroxy-5-(4-hydroxy-3,5-dimethoxyphenyl)spiro[5,7-dihydrocyclopenta[f][1,3]benzodioxole-6,3'-oxolane]-2'-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@H](O)[C@@]23CCOC3=O)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C21H20O8/c1-25-15-5-10(6-16(26-2)18(15)22)17-11-7-13-14(29-9-28-13)8-12(11)19(23)21(17)3-4-27-20(21)24/h5-8,17,19,22-23H,3-4,9H2,1-2H3/t17-,19+,21-/m1/s1 |
| InChIKey | UGTGWCLMXQQQFN-SLYNCCJLSA-N |
| XLogP | 2.25 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |