About 6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine
6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine (PubChem CID 148886875) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine.
Analyze 6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine (CID 148886875) is 6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine is CC1=CC2NC=CC2N=C1.
What is the InChIKey of 6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
The InChIKey is PEDLEHDAZDAIDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-6-4-8-7(10-5-6)2-3-9-8/h2-5,7-9H,1H3.
What are the key properties of 6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine has a molecular weight of 134.18 g/mol, XLogP of 0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 148886875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).