C18H14ClFN2O2 — CID 148889092
1-(2-chloro-4-fluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazole-3-carbaldehyde (PubChem CID 148889092) has the molecular formula C18H14ClFN2O2 and a molecular weight of 344.77 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazole-3-carbaldehyde.
| Compound Name | 1-(2-chloro-4-fluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 148889092 |
| Molecular Formula | C18H14ClFN2O2 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)-5-[(4-methoxyphenyl)methyl]pyrazole-3-carbaldehyde |
| SMILES | COc1ccc(Cc2cc(C=O)nn2-c2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C18H14ClFN2O2/c1-24-16-5-2-12(3-6-16)8-15-10-14(11-23)21-22(15)18-7-4-13(20)9-17(18)19/h2-7,9-11H,8H2,1H3 |
| InChIKey | PEOCVYQQWOGDBW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|