C25H29F2N5O4 — CID 148894098
13-cyclobutyl-11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[2-(2-hydroxyethylamino)ethyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 148894098) has the molecular formula C25H29F2N5O4 and a molecular weight of 501.53 g/mol. Its IUPAC name is 13-cyclobutyl-11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[2-(2-hydroxyethylamino)ethyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 13-cyclobutyl-11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[2-(2-hydroxyethylamino)ethyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 148894098 |
| Molecular Formula | C25H29F2N5O4 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 13-cyclobutyl-11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[2-(2-hydroxyethylamino)ethyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]c(CCNCCO)cc4c3N(C3CCC3)C2=O)c1F |
| InChI | InChI=1S/C25H29F2N5O4/c1-35-18-11-19(36-2)21(27)23(20(18)26)31-13-14-12-29-24-17(10-15(30-24)6-7-28-8-9-33)22(14)32(25(31)34)16-4-3-5-16/h10-12,16,28,33H,3-9,13H2,1-2H3,(H,29,30) |
| InChIKey | PFNCJUQKPZRKBA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|