C25H36O5 — CID 14890383
[(1S,2R,3R,4aR,5S,8aS)-4a,5-dimethyl-1-(3-methylbut-2-enoyloxy)-7-oxo-3-prop-1-en-2-yl-1,2,3,4,5,6,8,8a-octahydronaphthalen-2-yl] (E)-2-methylbut-2-enoate (PubChem CID 14890383) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is [(1S,2R,3R,4aR,5S,8aS)-4a,5-dimethyl-1-(3-methylbut-2-enoyloxy)-7-oxo-3-prop-1-en-2-yl-1,2,3,4,5,6,8,8a-octahydronaphthalen-2-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1S,2R,3R,4aR,5S,8aS)-4a,5-dimethyl-1-(3-methylbut-2-enoyloxy)-7-oxo-3-prop-1-en-2-yl-1,2,3,4,5,6,8,8a-octahydronaphthalen-2-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 14890383 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | [(1S,2R,3R,4aR,5S,8aS)-4a,5-dimethyl-1-(3-methylbut-2-enoyloxy)-7-oxo-3-prop-1-en-2-yl-1,2,3,4,5,6,8,8a-octahydronaphthalen-2-yl] (E)-2-methylbut-2-enoate |
| SMILES | C=C(C)[C@H]1C[C@@]2(C)[C@H](CC(=O)C[C@@H]2C)[C@H](OC(=O)C=C(C)C)[C@@H]1OC(=O)/C(C)=C/C |
| InChI | InChI=1S/C25H36O5/c1-9-16(6)24(28)30-22-19(15(4)5)13-25(8)17(7)11-18(26)12-20(25)23(22)29-21(27)10-14(2)3/h9-10,17,19-20,22-23H,4,11-13H2,1-3,5-8H3/b16-9+/t17-,19+,20+,22+,23-,25+/m0/s1 |
| InChIKey | UNJLGZXKJQZIHO-ABGKXLOESA-N |
| XLogP | 4.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|