C29H37N5O2S3 — CID 148904115
3-[3-imino-3-[N-[2-(2-methylphenyl)propanoyl]carbamimidoyl]sulfanylpropyl]sulfanylpropanimidoyl 4-(2-methylphenyl)-3-oxopentanimidothioate (PubChem CID 148904115) has the molecular formula C29H37N5O2S3 and a molecular weight of 583.85 g/mol. Its IUPAC name is 3-[3-imino-3-[N-[2-(2-methylphenyl)propanoyl]carbamimidoyl]sulfanylpropyl]sulfanylpropanimidoyl 4-(2-methylphenyl)-3-oxopentanimidothioate.
| Compound Name | 3-[3-imino-3-[N-[2-(2-methylphenyl)propanoyl]carbamimidoyl]sulfanylpropyl]sulfanylpropanimidoyl 4-(2-methylphenyl)-3-oxopentanimidothioate |
|---|---|
| PubChem CID | 148904115 |
| Molecular Formula | C29H37N5O2S3 |
| Molecular Weight | 583.85 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | 3-[3-imino-3-[N-[2-(2-methylphenyl)propanoyl]carbamimidoyl]sulfanylpropyl]sulfanylpropanimidoyl 4-(2-methylphenyl)-3-oxopentanimidothioate |
| SMILES | [H]/N=C(/CCSCC/C(=N\[H])S/C(=N\[H])NC(=O)C(C)c1ccccc1C)S/C(CC(=O)C(C)c1ccccc1C)=N/[H] |
| InChI | InChI=1S/C29H37N5O2S3/c1-18-9-5-7-11-22(18)20(3)24(35)17-27(32)38-25(30)13-15-37-16-14-26(31)39-29(33)34-28(36)21(4)23-12-8-6-10-19(23)2/h5-12,20-21,30-32H,13-17H2,1-4H3,(H2,33,34,36)/b30-25-,31-26+,32-27+ |
| InChIKey | PHJALSNYUPCLRJ-JZQQPSGLSA-N |
| XLogP | 7.13 |
| TPSA | 141.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.85 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|