C25H27Cl2N5O2S2 — CID 148537076
6-S-[N-[2-(2-chlorophenyl)acetyl]carbamimidoyl] 1-S-[4-(2-chlorophenyl)-3-oxobutanimidoyl] hexanediimidothioate (PubChem CID 148537076) has the molecular formula C25H27Cl2N5O2S2 and a molecular weight of 564.56 g/mol. Its IUPAC name is 6-S-[N-[2-(2-chlorophenyl)acetyl]carbamimidoyl] 1-S-[4-(2-chlorophenyl)-3-oxobutanimidoyl] hexanediimidothioate.
| Compound Name | 6-S-[N-[2-(2-chlorophenyl)acetyl]carbamimidoyl] 1-S-[4-(2-chlorophenyl)-3-oxobutanimidoyl] hexanediimidothioate |
|---|---|
| PubChem CID | 148537076 |
| Molecular Formula | C25H27Cl2N5O2S2 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | 6-S-[N-[2-(2-chlorophenyl)acetyl]carbamimidoyl] 1-S-[4-(2-chlorophenyl)-3-oxobutanimidoyl] hexanediimidothioate |
| SMILES | [H]/N=C(/CCCC/C(=N\[H])S/C(=N\[H])NC(=O)Cc1ccccc1Cl)S/C(CC(=O)Cc1ccccc1Cl)=N/[H] |
| InChI | InChI=1S/C25H27Cl2N5O2S2/c26-19-9-3-1-7-16(19)13-18(33)15-23(30)35-21(28)11-5-6-12-22(29)36-25(31)32-24(34)14-17-8-2-4-10-20(17)27/h1-4,7-10,28-30H,5-6,11-15H2,(H2,31,32,34)/b28-21-,29-22+,30-23+ |
| InChIKey | MRKZQLQCPZTAHN-PNFWQNDHSA-N |
| XLogP | 6.75 |
| TPSA | 141.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|