C27H31Cl2N5O2S3 — CID 146730949
3-[3-[N-[2-(2-chlorophenyl)propanoyl]carbamimidoyl]sulfanyl-3-iminopropyl]sulfanylpropanimidoyl 4-(2-chlorophenyl)-3-oxopentanimidothioate (PubChem CID 146730949) has the molecular formula C27H31Cl2N5O2S3 and a molecular weight of 624.69 g/mol. Its IUPAC name is 3-[3-[N-[2-(2-chlorophenyl)propanoyl]carbamimidoyl]sulfanyl-3-iminopropyl]sulfanylpropanimidoyl 4-(2-chlorophenyl)-3-oxopentanimidothioate.
| Compound Name | 3-[3-[N-[2-(2-chlorophenyl)propanoyl]carbamimidoyl]sulfanyl-3-iminopropyl]sulfanylpropanimidoyl 4-(2-chlorophenyl)-3-oxopentanimidothioate |
|---|---|
| PubChem CID | 146730949 |
| Molecular Formula | C27H31Cl2N5O2S3 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 623.10 |
| IUPAC Name | 3-[3-[N-[2-(2-chlorophenyl)propanoyl]carbamimidoyl]sulfanyl-3-iminopropyl]sulfanylpropanimidoyl 4-(2-chlorophenyl)-3-oxopentanimidothioate |
| SMILES | [H]/N=C(/CCSCC/C(=N\[H])S/C(=N\[H])NC(=O)C(C)c1ccccc1Cl)S/C(CC(=O)C(C)c1ccccc1Cl)=N/[H] |
| InChI | InChI=1S/C27H31Cl2N5O2S3/c1-16(18-7-3-5-9-20(18)28)22(35)15-25(32)38-23(30)11-13-37-14-12-24(31)39-27(33)34-26(36)17(2)19-8-4-6-10-21(19)29/h3-10,16-17,30-32H,11-15H2,1-2H3,(H2,33,34,36)/b30-23-,31-24+,32-25+ |
| InChIKey | RHWKXMWNOIROTB-OKXPFZMQSA-N |
| XLogP | 7.82 |
| TPSA | 141.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|