About 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium
4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium (PubChem CID 148912646) has the molecular formula C8H13O4Y-
and a molecular weight of 262.09 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium.
Molecular Properties
| Compound Name | 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium |
| PubChem CID | 148912646 |
| Molecular Formula | C8H13O4Y- |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium |
| SMILES | CC(C)(C)OC(=O)C[CH-]C(=O)O.[Y] |
| InChI | InChI=1S/C8H13O4.Y/c1-8(2,3)12-7(11)5-4-6(9)10;/h4H,5H2,1-3H3,(H,9,10);/q-1; |
| InChIKey | CDLDXNLWCDJOEF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium?
The IUPAC name of 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium (CID 148912646) is 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium.
What is the SMILES notation for 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium?
The canonical SMILES for 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium is CC(C)(C)OC(=O)C[CH-]C(=O)O.[Y].
What is the InChIKey of 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium?
The InChIKey is CDLDXNLWCDJOEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13O4.Y/c1-8(2,3)12-7(11)5-4-6(9)10;/h4H,5H2,1-3H3,(H,9,10);/q-1;.
What are the key properties of 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium?
4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium has a molecular weight of 262.09 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;yttrium is sourced from PubChem (CID 148912646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).