C20H27N3O3 — CID 148921406
[2-amino-5-[2-(3-amino-4-tert-butylphenyl)ethoxy]phenyl]-methylcarbamic acid (PubChem CID 148921406) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is [2-amino-5-[2-(3-amino-4-tert-butylphenyl)ethoxy]phenyl]-methylcarbamic acid.
| Compound Name | [2-amino-5-[2-(3-amino-4-tert-butylphenyl)ethoxy]phenyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 148921406 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | [2-amino-5-[2-(3-amino-4-tert-butylphenyl)ethoxy]phenyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1cc(OCCc2ccc(C(C)(C)C)c(N)c2)ccc1N |
| InChI | InChI=1S/C20H27N3O3/c1-20(2,3)15-7-5-13(11-17(15)22)9-10-26-14-6-8-16(21)18(12-14)23(4)19(24)25/h5-8,11-12H,9-10,21-22H2,1-4H3,(H,24,25) |
| InChIKey | GIMVFGOJFOXQQK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|