About 1-anthracen-1-ylethyl 2,2-dimethylpropanoate
1-anthracen-1-ylethyl 2,2-dimethylpropanoate (PubChem CID 148923843) has the molecular formula C21H22O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-anthracen-1-ylethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 1-anthracen-1-ylethyl 2,2-dimethylpropanoate |
| PubChem CID | 148923843 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-anthracen-1-ylethyl 2,2-dimethylpropanoate |
| SMILES | CC(OC(=O)C(C)(C)C)c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C21H22O2/c1-14(23-20(22)21(2,3)4)18-11-7-10-17-12-15-8-5-6-9-16(15)13-19(17)18/h5-14H,1-4H3 |
| InChIKey | PKPKUDWSGCSHAO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-anthracen-1-ylethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anthracen-1-ylethyl 2,2-dimethylpropanoate?
The IUPAC name of 1-anthracen-1-ylethyl 2,2-dimethylpropanoate (CID 148923843) is 1-anthracen-1-ylethyl 2,2-dimethylpropanoate.
What is the SMILES notation for 1-anthracen-1-ylethyl 2,2-dimethylpropanoate?
The canonical SMILES for 1-anthracen-1-ylethyl 2,2-dimethylpropanoate is CC(OC(=O)C(C)(C)C)c1cccc2cc3ccccc3cc12.
What is the InChIKey of 1-anthracen-1-ylethyl 2,2-dimethylpropanoate?
The InChIKey is PKPKUDWSGCSHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O2/c1-14(23-20(22)21(2,3)4)18-11-7-10-17-12-15-8-5-6-9-16(15)13-19(17)18/h5-14H,1-4H3.
What are the key properties of 1-anthracen-1-ylethyl 2,2-dimethylpropanoate?
1-anthracen-1-ylethyl 2,2-dimethylpropanoate has a molecular weight of 306.41 g/mol, XLogP of 5.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anthracen-1-ylethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 148923843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).