C28H39N3O2 — CID 148935807
1-(5-methyl-1H-imidazol-2-yl)-2-[2-(2,5,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]ethanone (PubChem CID 148935807) has the molecular formula C28H39N3O2 and a molecular weight of 453.66 g/mol. Its IUPAC name is 1-(5-methyl-1H-imidazol-2-yl)-2-[2-(2,5,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]ethanone.
| Compound Name | 1-(5-methyl-1H-imidazol-2-yl)-2-[2-(2,5,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 148935807 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 453.33 |
| IUPAC Name | 1-(5-methyl-1H-imidazol-2-yl)-2-[2-(2,5,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-6-(2,2,6,6-tetramethyloxan-4-yl)-3-pyridinyl]ethanone |
| SMILES | [2H]C1=C(c2nc(C3CC(C)(C)OC(C)(C)C3)ccc2CC(=O)c2ncc(C)[nH]2)C([2H])([2H])C([2H])C(C)(C)C1 |
| InChI | InChI=1S/C28H39N3O2/c1-18-17-29-25(30-18)23(32)14-20-8-9-22(21-15-27(4,5)33-28(6,7)16-21)31-24(20)19-10-12-26(2,3)13-11-19/h8-10,17,21H,11-16H2,1-7H3,(H,29,30)/i10D,11D2,13D |
| InChIKey | PMXWHKBJJXRBJM-PIOQZCQLSA-N |
| XLogP | 6.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |