About 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile
2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile (PubChem CID 14895200) has the molecular formula C13H9N
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile.
Molecular Properties
| Compound Name | 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile |
| PubChem CID | 14895200 |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile |
| SMILES | N#CC1=CC2C=CC2c2ccccc21 |
| InChI | InChI=1S/C13H9N/c14-8-10-7-9-5-6-12(9)13-4-2-1-3-11(10)13/h1-7,9,12H |
| InChIKey | RUMFLTVKTOQWGY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile?
The IUPAC name of 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile (CID 14895200) is 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile.
What is the SMILES notation for 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile?
The canonical SMILES for 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile is N#CC1=CC2C=CC2c2ccccc21.
What is the InChIKey of 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile?
The InChIKey is RUMFLTVKTOQWGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N/c14-8-10-7-9-5-6-12(9)13-4-2-1-3-11(10)13/h1-7,9,12H.
What are the key properties of 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile?
2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile has a molecular weight of 179.22 g/mol, XLogP of 2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2a,8b-dihydrocyclobuta[a]naphthalene-4-carbonitrile is sourced from PubChem (CID 14895200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).