C11H11ClO2S2 — CID 14895408
1-(4-chlorophenyl)-3,3-bis(methylsulfanyl)propane-1,2-dione (PubChem CID 14895408) has the molecular formula C11H11ClO2S2 and a molecular weight of 274.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,3-bis(methylsulfanyl)propane-1,2-dione.
| Compound Name | 1-(4-chlorophenyl)-3,3-bis(methylsulfanyl)propane-1,2-dione |
|---|---|
| PubChem CID | 14895408 |
| Molecular Formula | C11H11ClO2S2 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 1-(4-chlorophenyl)-3,3-bis(methylsulfanyl)propane-1,2-dione |
| SMILES | CSC(SC)C(=O)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11ClO2S2/c1-15-11(16-2)10(14)9(13)7-3-5-8(12)6-4-7/h3-6,11H,1-2H3 |
| InChIKey | YTRYXAKZXHIZIU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|