C12H14ClNO2S2 — CID 97049733
2-[(S)-amino(hydroxy)methyl]-1-(4-chlorophenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one (PubChem CID 97049733) has the molecular formula C12H14ClNO2S2 and a molecular weight of 303.84 g/mol. Its IUPAC name is 2-[(S)-amino(hydroxy)methyl]-1-(4-chlorophenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one.
| Compound Name | 2-[(S)-amino(hydroxy)methyl]-1-(4-chlorophenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 97049733 |
| Molecular Formula | C12H14ClNO2S2 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-[(S)-amino(hydroxy)methyl]-1-(4-chlorophenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one |
| SMILES | CSC(SC)=C(C(=O)c1ccc(Cl)cc1)[C@@H](N)O |
| InChI | InChI=1S/C12H14ClNO2S2/c1-17-12(18-2)9(11(14)16)10(15)7-3-5-8(13)6-4-7/h3-6,11,16H,14H2,1-2H3/t11-/m0/s1 |
| InChIKey | YINGNBUTCMKIPG-NSHDSACASA-N |
| XLogP | 2.74 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|