C20H16Cl2O3 — CID 14895430
[(1R)-1-(6-methoxynaphthalen-2-yl)ethyl] 3,5-dichlorobenzoate (PubChem CID 14895430) has the molecular formula C20H16Cl2O3 and a molecular weight of 375.25 g/mol. Its IUPAC name is [(1R)-1-(6-methoxynaphthalen-2-yl)ethyl] 3,5-dichlorobenzoate.
| Compound Name | [(1R)-1-(6-methoxynaphthalen-2-yl)ethyl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 14895430 |
| Molecular Formula | C20H16Cl2O3 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | [(1R)-1-(6-methoxynaphthalen-2-yl)ethyl] 3,5-dichlorobenzoate |
| SMILES | COc1ccc2cc([C@@H](C)OC(=O)c3cc(Cl)cc(Cl)c3)ccc2c1 |
| InChI | InChI=1S/C20H16Cl2O3/c1-12(25-20(23)16-8-17(21)11-18(22)9-16)13-3-4-15-10-19(24-2)6-5-14(15)7-13/h3-12H,1-2H3/t12-/m1/s1 |
| InChIKey | KOMBVZATZGRILN-GFCCVEGCSA-N |
| XLogP | 6.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |