C24H29FN2O — CID 148955217
3-fluoro-4-[3-[2-(2-phenylcyclopropyl)ethyl]azetidin-1-yl]-N-propan-2-ylbenzamide (PubChem CID 148955217) has the molecular formula C24H29FN2O and a molecular weight of 380.51 g/mol. Its IUPAC name is 3-fluoro-4-[3-[2-(2-phenylcyclopropyl)ethyl]azetidin-1-yl]-N-propan-2-ylbenzamide.
| Compound Name | 3-fluoro-4-[3-[2-(2-phenylcyclopropyl)ethyl]azetidin-1-yl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 148955217 |
| Molecular Formula | C24H29FN2O |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 3-fluoro-4-[3-[2-(2-phenylcyclopropyl)ethyl]azetidin-1-yl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(N2CC(CCC3CC3c3ccccc3)C2)c(F)c1 |
| InChI | InChI=1S/C24H29FN2O/c1-16(2)26-24(28)20-10-11-23(22(25)13-20)27-14-17(15-27)8-9-19-12-21(19)18-6-4-3-5-7-18/h3-7,10-11,13,16-17,19,21H,8-9,12,14-15H2,1-2H3,(H,26,28) |
| InChIKey | PQSIYCCYUAQZSE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |