C23H37NO2 — CID 14895665
N,N-diethyl-3-[(1,3,3-trimethyl-6-phenyl-2-oxabicyclo[2.2.2]octan-6-yl)oxy]propan-1-amine (PubChem CID 14895665) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is N,N-diethyl-3-[(1,3,3-trimethyl-6-phenyl-2-oxabicyclo[2.2.2]octan-6-yl)oxy]propan-1-amine.
| Compound Name | N,N-diethyl-3-[(1,3,3-trimethyl-6-phenyl-2-oxabicyclo[2.2.2]octan-6-yl)oxy]propan-1-amine |
|---|---|
| PubChem CID | 14895665 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | N,N-diethyl-3-[(1,3,3-trimethyl-6-phenyl-2-oxabicyclo[2.2.2]octan-6-yl)oxy]propan-1-amine |
| SMILES | CCN(CC)CCCOC1(c2ccccc2)CC2CCC1(C)OC2(C)C |
| InChI | InChI=1S/C23H37NO2/c1-6-24(7-2)16-11-17-25-23(19-12-9-8-10-13-19)18-20-14-15-22(23,5)26-21(20,3)4/h8-10,12-13,20H,6-7,11,14-18H2,1-5H3 |
| InChIKey | GWWRXCKWVKSIOU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|