C29H31F3N4O3 — CID 148963064
5-[2-[1,4-dimethyl-3-[(2S,4R)-2-methyl-1-[(2R)-3,3,3-trifluoro-2-methylpropanoyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-5-yl]acetyl]-2-methoxybenzonitrile (PubChem CID 148963064) has the molecular formula C29H31F3N4O3 and a molecular weight of 540.59 g/mol. Its IUPAC name is 5-[2-[1,4-dimethyl-3-[(2S,4R)-2-methyl-1-[(2R)-3,3,3-trifluoro-2-methylpropanoyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-5-yl]acetyl]-2-methoxybenzonitrile.
| Compound Name | 5-[2-[1,4-dimethyl-3-[(2S,4R)-2-methyl-1-[(2R)-3,3,3-trifluoro-2-methylpropanoyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-5-yl]acetyl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 148963064 |
| Molecular Formula | C29H31F3N4O3 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 5-[2-[1,4-dimethyl-3-[(2S,4R)-2-methyl-1-[(2R)-3,3,3-trifluoro-2-methylpropanoyl]piperidin-4-yl]pyrrolo[2,3-b]pyridin-5-yl]acetyl]-2-methoxybenzonitrile |
| SMILES | COc1ccc(C(=O)Cc2cnc3c(c([C@@H]4CCN(C(=O)[C@@H](C)C(F)(F)F)[C@@H](C)C4)cn3C)c2C)cc1C#N |
| InChI | InChI=1S/C29H31F3N4O3/c1-16-10-19(8-9-36(16)28(38)18(3)29(30,31)32)23-15-35(4)27-26(23)17(2)22(14-34-27)12-24(37)20-6-7-25(39-5)21(11-20)13-33/h6-7,11,14-16,18-19H,8-10,12H2,1-5H3/t16-,18+,19+/m0/s1 |
| InChIKey | PSEYHKAKLNLYNY-QXAKKESOSA-N |
| XLogP | 5.48 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |