C17H19ClFN3O3 — CID 14896557
8-chloro-1-ethyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 14896557) has the molecular formula C17H19ClFN3O3 and a molecular weight of 367.81 g/mol. Its IUPAC name is 8-chloro-1-ethyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 8-chloro-1-ethyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 14896557 |
| Molecular Formula | C17H19ClFN3O3 |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 8-chloro-1-ethyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNC(C)C3)c(Cl)c21 |
| InChI | InChI=1S/C17H19ClFN3O3/c1-3-21-8-11(17(24)25)16(23)10-6-12(19)15(13(18)14(10)21)22-5-4-20-9(2)7-22/h6,8-9,20H,3-5,7H2,1-2H3,(H,24,25) |
| InChIKey | FFGTWOOAZSQXPJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |