C20H15N3O2 — CID 14896600
4-methoxy-N-(1,10-phenanthrolin-2-yl)benzamide (PubChem CID 14896600) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-methoxy-N-(1,10-phenanthrolin-2-yl)benzamide.
| Compound Name | 4-methoxy-N-(1,10-phenanthrolin-2-yl)benzamide |
|---|---|
| PubChem CID | 14896600 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-methoxy-N-(1,10-phenanthrolin-2-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3ccc4cccnc4c3n2)cc1 |
| InChI | InChI=1S/C20H15N3O2/c1-25-16-9-6-15(7-10-16)20(24)23-17-11-8-14-5-4-13-3-2-12-21-18(13)19(14)22-17/h2-12H,1H3,(H,22,23,24) |
| InChIKey | BEJXBXQWIBLCNR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|