C21H16O6S2 — CID 14896687
1,1'-dimethoxy-10,10'-spirobi[12-oxa-11-thiatricyclo[7.2.1.02,7]dodeca-2,4,6-triene]-8,8'-dione (PubChem CID 14896687) has the molecular formula C21H16O6S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is 1,1'-dimethoxy-10,10'-spirobi[12-oxa-11-thiatricyclo[7.2.1.02,7]dodeca-2,4,6-triene]-8,8'-dione.
| Compound Name | 1,1'-dimethoxy-10,10'-spirobi[12-oxa-11-thiatricyclo[7.2.1.02,7]dodeca-2,4,6-triene]-8,8'-dione |
|---|---|
| PubChem CID | 14896687 |
| Molecular Formula | C21H16O6S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 1,1'-dimethoxy-10,10'-spirobi[12-oxa-11-thiatricyclo[7.2.1.02,7]dodeca-2,4,6-triene]-8,8'-dione |
| SMILES | COC12OC(C(=O)c3ccccc31)C1(S2)SC2(OC)OC1C(=O)c1ccccc12 |
| InChI | InChI=1S/C21H16O6S2/c1-24-20-13-9-5-3-7-11(13)15(22)17(26-20)19(28-20)18-16(23)12-8-4-6-10-14(12)21(25-2,27-18)29-19/h3-10,17-18H,1-2H3 |
| InChIKey | WCQSTQWHSPMNNB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |