C19H18O5 — CID 102011965
(1R,9S,10R)-1-methoxy-10-(phenylmethoxymethyl)-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one (PubChem CID 102011965) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (1R,9S,10R)-1-methoxy-10-(phenylmethoxymethyl)-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one.
| Compound Name | (1R,9S,10R)-1-methoxy-10-(phenylmethoxymethyl)-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 102011965 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (1R,9S,10R)-1-methoxy-10-(phenylmethoxymethyl)-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
| SMILES | CO[C@]12O[C@H](C(=O)c3ccccc31)[C@@H](COCc1ccccc1)O2 |
| InChI | InChI=1S/C19H18O5/c1-21-19-15-10-6-5-9-14(15)17(20)18(24-19)16(23-19)12-22-11-13-7-3-2-4-8-13/h2-10,16,18H,11-12H2,1H3/t16-,18+,19-/m1/s1 |
| InChIKey | FTDLSSVEQLUDFH-NZSAHSFTSA-N |
| XLogP | 2.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |