C23H18O6 — CID 42625066
(11R,15R,17S)-17-(phenylmethoxymethyl)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione (PubChem CID 42625066) has the molecular formula C23H18O6 and a molecular weight of 390.39 g/mol. Its IUPAC name is (11R,15R,17S)-17-(phenylmethoxymethyl)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione.
| Compound Name | (11R,15R,17S)-17-(phenylmethoxymethyl)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione |
|---|---|
| PubChem CID | 42625066 |
| Molecular Formula | C23H18O6 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (11R,15R,17S)-17-(phenylmethoxymethyl)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione |
| SMILES | O=C1C[C@H]2O[C@H](COCc3ccccc3)C3=C(C(=O)c4ccccc4C3=O)[C@H]2O1 |
| InChI | InChI=1S/C23H18O6/c24-18-10-16-23(29-18)20-19(21(25)14-8-4-5-9-15(14)22(20)26)17(28-16)12-27-11-13-6-2-1-3-7-13/h1-9,16-17,23H,10-12H2/t16-,17-,23+/m1/s1 |
| InChIKey | AOWGZOCUPHAWLJ-QZMQVMSPSA-N |
| XLogP | 2.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|