C19H17FO5 — CID 11313933
(1S,9R,10R)-10-[(4-fluorophenyl)methoxymethyl]-1-methoxy-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one (PubChem CID 11313933) has the molecular formula C19H17FO5 and a molecular weight of 344.34 g/mol. Its IUPAC name is (1S,9R,10R)-10-[(4-fluorophenyl)methoxymethyl]-1-methoxy-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one.
| Compound Name | (1S,9R,10R)-10-[(4-fluorophenyl)methoxymethyl]-1-methoxy-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 11313933 |
| Molecular Formula | C19H17FO5 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (1S,9R,10R)-10-[(4-fluorophenyl)methoxymethyl]-1-methoxy-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-8-one |
| SMILES | CO[C@@]12O[C@H](COCc3ccc(F)cc3)[C@@H](O1)C(=O)c1ccccc12 |
| InChI | InChI=1S/C19H17FO5/c1-22-19-15-5-3-2-4-14(15)17(21)18(25-19)16(24-19)11-23-10-12-6-8-13(20)9-7-12/h2-9,16,18H,10-11H2,1H3/t16-,18-,19+/m1/s1 |
| InChIKey | UEXJNPDRUHUOIC-QRQLOZEOSA-N |
| XLogP | 2.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |