C23H20O4 — CID 24871419
(13S)-13-butyl-12,21-dioxapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2(11),4,6,8,15,17,19-heptaene-3,10-dione (PubChem CID 24871419) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is (13S)-13-butyl-12,21-dioxapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2(11),4,6,8,15,17,19-heptaene-3,10-dione.
| Compound Name | (13S)-13-butyl-12,21-dioxapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2(11),4,6,8,15,17,19-heptaene-3,10-dione |
|---|---|
| PubChem CID | 24871419 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (13S)-13-butyl-12,21-dioxapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2(11),4,6,8,15,17,19-heptaene-3,10-dione |
| SMILES | CCCC[C@]12Cc3ccccc3C(O1)C1=C(O2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H20O4/c1-2-3-12-23-13-14-8-4-5-9-15(14)21(26-23)18-19(24)16-10-6-7-11-17(16)20(25)22(18)27-23/h4-11,21H,2-3,12-13H2,1H3/t21?,23-/m0/s1 |
| InChIKey | AVEBNCKZKRRBEC-YANBTOMASA-N |
| XLogP | 4.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|