C6H13N3O2 — CID 148983646
2-[[(Z)-2-amino-3-(methylamino)prop-2-enyl]amino]acetic acid (PubChem CID 148983646) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-[[(Z)-2-amino-3-(methylamino)prop-2-enyl]amino]acetic acid.
| Compound Name | 2-[[(Z)-2-amino-3-(methylamino)prop-2-enyl]amino]acetic acid |
|---|---|
| PubChem CID | 148983646 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-[[(Z)-2-amino-3-(methylamino)prop-2-enyl]amino]acetic acid |
| SMILES | CN/C=C(\N)CNCC(=O)O |
| InChI | InChI=1S/C6H13N3O2/c1-8-2-5(7)3-9-4-6(10)11/h2,8-9H,3-4,7H2,1H3,(H,10,11)/b5-2- |
| InChIKey | PWFRVYQNGBDQPK-DJWKRKHSSA-N |
| XLogP | -1.32 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |