C13H22N3O8+ — CID 90908505
2-aminoethyl-[2-[bis(carboxymethyl)amino]prop-2-enyl]-bis(carboxymethyl)azanium (PubChem CID 90908505) has the molecular formula C13H22N3O8+ and a molecular weight of 348.33 g/mol. Its IUPAC name is 2-aminoethyl-[2-[bis(carboxymethyl)amino]prop-2-enyl]-bis(carboxymethyl)azanium.
| Compound Name | 2-aminoethyl-[2-[bis(carboxymethyl)amino]prop-2-enyl]-bis(carboxymethyl)azanium |
|---|---|
| PubChem CID | 90908505 |
| Molecular Formula | C13H22N3O8+ |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-aminoethyl-[2-[bis(carboxymethyl)amino]prop-2-enyl]-bis(carboxymethyl)azanium |
| SMILES | C=C(C[N+](CCN)(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C13H21N3O8/c1-9(15(4-10(17)18)5-11(19)20)6-16(3-2-14,7-12(21)22)8-13(23)24/h1-8,14H2,(H3-,17,18,19,20,21,22,23,24)/p+1 |
| InChIKey | VNTNQUPRZHUKJK-UHFFFAOYSA-O |
| XLogP | -2.08 |
| TPSA | 178.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|