C25H24F3N3O5S — CID 148986020
8-[[4-[4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carbonyl]phenyl]methylsulfonyl]-3H-quinazolin-4-one (PubChem CID 148986020) has the molecular formula C25H24F3N3O5S and a molecular weight of 535.54 g/mol. Its IUPAC name is 8-[[4-[4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carbonyl]phenyl]methylsulfonyl]-3H-quinazolin-4-one.
| Compound Name | 8-[[4-[4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carbonyl]phenyl]methylsulfonyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 148986020 |
| Molecular Formula | C25H24F3N3O5S |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 8-[[4-[4-hydroxy-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidine-1-carbonyl]phenyl]methylsulfonyl]-3H-quinazolin-4-one |
| SMILES | O=C(c1ccc(CS(=O)(=O)c2cccc3c(=O)[nH]cnc23)cc1)N1CCC(O)(/C=C/CC(F)(F)F)CC1 |
| InChI | InChI=1S/C25H24F3N3O5S/c26-25(27,28)10-2-9-24(34)11-13-31(14-12-24)23(33)18-7-5-17(6-8-18)15-37(35,36)20-4-1-3-19-21(20)29-16-30-22(19)32/h1-9,16,34H,10-15H2,(H,29,30,32)/b9-2+ |
| InChIKey | PWRLKQYGTLVHBN-XNWCZRBMSA-N |
| XLogP | 3.37 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|