C28H26FN3O4S — CID 152901793
[4-(6-fluoro-2-methyl-3-pyridinyl)-4-hydroxypiperidin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone (PubChem CID 152901793) has the molecular formula C28H26FN3O4S and a molecular weight of 519.60 g/mol. Its IUPAC name is [4-(6-fluoro-2-methyl-3-pyridinyl)-4-hydroxypiperidin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone.
| Compound Name | [4-(6-fluoro-2-methyl-3-pyridinyl)-4-hydroxypiperidin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 152901793 |
| Molecular Formula | C28H26FN3O4S |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | [4-(6-fluoro-2-methyl-3-pyridinyl)-4-hydroxypiperidin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone |
| SMILES | Cc1nc(F)ccc1C1(O)CCN(C(=O)c2ccc(CS(=O)(=O)c3cccc4cccnc34)cc2)CC1 |
| InChI | InChI=1S/C28H26FN3O4S/c1-19-23(11-12-25(29)31-19)28(34)13-16-32(17-14-28)27(33)22-9-7-20(8-10-22)18-37(35,36)24-6-2-4-21-5-3-15-30-26(21)24/h2-12,15,34H,13-14,16-18H2,1H3 |
| InChIKey | UFMAWTJOVPZJPB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|