C28H31N3O4S — CID 149279946
cyclohexyl-[4-[4-(quinolin-8-ylsulfonylmethyl)benzoyl]piperazin-1-yl]methanone (PubChem CID 149279946) has the molecular formula C28H31N3O4S and a molecular weight of 505.64 g/mol. Its IUPAC name is cyclohexyl-[4-[4-(quinolin-8-ylsulfonylmethyl)benzoyl]piperazin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-[4-(quinolin-8-ylsulfonylmethyl)benzoyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 149279946 |
| Molecular Formula | C28H31N3O4S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | cyclohexyl-[4-[4-(quinolin-8-ylsulfonylmethyl)benzoyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(CS(=O)(=O)c2cccc3cccnc23)cc1)N1CCN(C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C28H31N3O4S/c32-27(23-6-2-1-3-7-23)30-16-18-31(19-17-30)28(33)24-13-11-21(12-14-24)20-36(34,35)25-10-4-8-22-9-5-15-29-26(22)25/h4-5,8-15,23H,1-3,6-7,16-20H2 |
| InChIKey | XSTGYOGLRAIFLU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |