C29H29N3O3S — CID 159349787
[4-(1-phenylethyl)piperazin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone (PubChem CID 159349787) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is [4-(1-phenylethyl)piperazin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone.
| Compound Name | [4-(1-phenylethyl)piperazin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 159349787 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | [4-(1-phenylethyl)piperazin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone |
| SMILES | CC(c1ccccc1)N1CCN(C(=O)c2ccc(CS(=O)(=O)c3cccc4cccnc34)cc2)CC1 |
| InChI | InChI=1S/C29H29N3O3S/c1-22(24-7-3-2-4-8-24)31-17-19-32(20-18-31)29(33)26-14-12-23(13-15-26)21-36(34,35)27-11-5-9-25-10-6-16-30-28(25)27/h2-16,22H,17-21H2,1H3 |
| InChIKey | LHEKHMUFWRXYHU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |