C28H27N3O4S2 — CID 147912240
1-[4-[4-(quinolin-8-ylsulfonylmethyl)benzoyl]piperazin-1-yl]-3-thiophen-2-ylpropan-1-one (PubChem CID 147912240) has the molecular formula C28H27N3O4S2 and a molecular weight of 533.68 g/mol. Its IUPAC name is 1-[4-[4-(quinolin-8-ylsulfonylmethyl)benzoyl]piperazin-1-yl]-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-[4-[4-(quinolin-8-ylsulfonylmethyl)benzoyl]piperazin-1-yl]-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 147912240 |
| Molecular Formula | C28H27N3O4S2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 1-[4-[4-(quinolin-8-ylsulfonylmethyl)benzoyl]piperazin-1-yl]-3-thiophen-2-ylpropan-1-one |
| SMILES | O=C(CCc1cccs1)N1CCN(C(=O)c2ccc(CS(=O)(=O)c3cccc4cccnc34)cc2)CC1 |
| InChI | InChI=1S/C28H27N3O4S2/c32-26(13-12-24-6-3-19-36-24)30-15-17-31(18-16-30)28(33)23-10-8-21(9-11-23)20-37(34,35)25-7-1-4-22-5-2-14-29-27(22)25/h1-11,14,19H,12-13,15-18,20H2 |
| InChIKey | IGJBUKRXCPWLLA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |