C29H26N4O3S — CID 147586583
[4-[(3-isocyanophenyl)methyl]piperazin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone (PubChem CID 147586583) has the molecular formula C29H26N4O3S and a molecular weight of 510.62 g/mol. Its IUPAC name is [4-[(3-isocyanophenyl)methyl]piperazin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone.
| Compound Name | [4-[(3-isocyanophenyl)methyl]piperazin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 147586583 |
| Molecular Formula | C29H26N4O3S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | [4-[(3-isocyanophenyl)methyl]piperazin-1-yl]-[4-(quinolin-8-ylsulfonylmethyl)phenyl]methanone |
| SMILES | [C-]#[N+]c1cccc(CN2CCN(C(=O)c3ccc(CS(=O)(=O)c4cccc5cccnc45)cc3)CC2)c1 |
| InChI | InChI=1S/C29H26N4O3S/c1-30-26-8-2-5-23(19-26)20-32-15-17-33(18-16-32)29(34)25-12-10-22(11-13-25)21-37(35,36)27-9-3-6-24-7-4-14-31-28(24)27/h2-14,19H,15-18,20-21H2 |
| InChIKey | FXLMKUFEKXPFJD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|