C28H24ClFN2O4S — CID 152867731
[4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(2-fluoroquinolin-5-yl)sulfonylmethyl]phenyl]methanone (PubChem CID 152867731) has the molecular formula C28H24ClFN2O4S and a molecular weight of 539.03 g/mol. Its IUPAC name is [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(2-fluoroquinolin-5-yl)sulfonylmethyl]phenyl]methanone.
| Compound Name | [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(2-fluoroquinolin-5-yl)sulfonylmethyl]phenyl]methanone |
|---|---|
| PubChem CID | 152867731 |
| Molecular Formula | C28H24ClFN2O4S |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-[(2-fluoroquinolin-5-yl)sulfonylmethyl]phenyl]methanone |
| SMILES | O=C(c1ccc(CS(=O)(=O)c2cccc3nc(F)ccc23)cc1)N1CCC(O)(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C28H24ClFN2O4S/c29-23-5-2-1-4-22(23)28(34)14-16-32(17-15-28)27(33)20-10-8-19(9-11-20)18-37(35,36)25-7-3-6-24-21(25)12-13-26(30)31-24/h1-13,34H,14-18H2 |
| InChIKey | TYUHWNINLBZWMD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|