C11H9N3OS — CID 14898745
2-(1,3-thiazol-5-ylmethyl)-1H-indazol-3-one (PubChem CID 14898745) has the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. Its IUPAC name is 2-(1,3-thiazol-5-ylmethyl)-1H-indazol-3-one.
| Compound Name | 2-(1,3-thiazol-5-ylmethyl)-1H-indazol-3-one |
|---|---|
| PubChem CID | 14898745 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-(1,3-thiazol-5-ylmethyl)-1H-indazol-3-one |
| SMILES | O=c1c2ccccc2[nH]n1Cc1cncs1 |
| InChI | InChI=1S/C11H9N3OS/c15-11-9-3-1-2-4-10(9)13-14(11)6-8-5-12-7-16-8/h1-5,7,13H,6H2 |
| InChIKey | KPXSUQVYEHMEMW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|