C13H14FN3OS — CID 54906209
2-amino-5-fluoro-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide (PubChem CID 54906209) has the molecular formula C13H14FN3OS and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-amino-5-fluoro-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide.
| Compound Name | 2-amino-5-fluoro-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 54906209 |
| Molecular Formula | C13H14FN3OS |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-amino-5-fluoro-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide |
| SMILES | Cc1ncc(CN(C)C(=O)c2cc(F)ccc2N)s1 |
| InChI | InChI=1S/C13H14FN3OS/c1-8-16-6-10(19-8)7-17(2)13(18)11-5-9(14)3-4-12(11)15/h3-6H,7,15H2,1-2H3 |
| InChIKey | BJJLNUBMCXBKMF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|