C20H27ClN6O — CID 148992239
2-chloro-N-[4-[4-[methyl-[[methyl-[2-(methylamino)ethenyl]amino]methylamino]amino]anilino]phenyl]acetamide (PubChem CID 148992239) has the molecular formula C20H27ClN6O and a molecular weight of 402.93 g/mol. Its IUPAC name is 2-chloro-N-[4-[4-[methyl-[[methyl-[2-(methylamino)ethenyl]amino]methylamino]amino]anilino]phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-[4-[methyl-[[methyl-[2-(methylamino)ethenyl]amino]methylamino]amino]anilino]phenyl]acetamide |
|---|---|
| PubChem CID | 148992239 |
| Molecular Formula | C20H27ClN6O |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-chloro-N-[4-[4-[methyl-[[methyl-[2-(methylamino)ethenyl]amino]methylamino]amino]anilino]phenyl]acetamide |
| SMILES | CNC=CN(C)CNN(C)c1ccc(Nc2ccc(NC(=O)CCl)cc2)cc1 |
| InChI | InChI=1S/C20H27ClN6O/c1-22-12-13-26(2)15-23-27(3)19-10-8-17(9-11-19)24-16-4-6-18(7-5-16)25-20(28)14-21/h4-13,22-24H,14-15H2,1-3H3,(H,25,28) |
| InChIKey | PXXVKARZQNJTDB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|