C24H36N6 — CID 143565773
1-N-[4-(diethylamino)phenyl]-4-N-methyl-4-N-[(E)-1-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propan-2-ylideneamino]benzene-1,4-diamine (PubChem CID 143565773) has the molecular formula C24H36N6 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-N-[4-(diethylamino)phenyl]-4-N-methyl-4-N-[(E)-1-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propan-2-ylideneamino]benzene-1,4-diamine.
| Compound Name | 1-N-[4-(diethylamino)phenyl]-4-N-methyl-4-N-[(E)-1-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propan-2-ylideneamino]benzene-1,4-diamine |
|---|---|
| PubChem CID | 143565773 |
| Molecular Formula | C24H36N6 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 1-N-[4-(diethylamino)phenyl]-4-N-methyl-4-N-[(E)-1-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propan-2-ylideneamino]benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2ccc(N(C)/N=C(\C)CN(C)/C=C\NC)cc2)cc1 |
| InChI | InChI=1S/C24H36N6/c1-7-30(8-2)24-15-11-22(12-16-24)26-21-9-13-23(14-10-21)29(6)27-20(3)19-28(5)18-17-25-4/h9-18,25-26H,7-8,19H2,1-6H3/b18-17-,27-20+ |
| InChIKey | TZMJYTCXUIFITH-DBMYSJMESA-N |
| XLogP | 4.71 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|