C23H31N5O4 — CID 143565779
ethyl (2Z)-2-[[4-[(2,4-dihydroxyphenyl)methylamino]phenyl]-methylhydrazinylidene]-3-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propanoate (PubChem CID 143565779) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is ethyl (2Z)-2-[[4-[(2,4-dihydroxyphenyl)methylamino]phenyl]-methylhydrazinylidene]-3-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propanoate.
| Compound Name | ethyl (2Z)-2-[[4-[(2,4-dihydroxyphenyl)methylamino]phenyl]-methylhydrazinylidene]-3-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propanoate |
|---|---|
| PubChem CID | 143565779 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | ethyl (2Z)-2-[[4-[(2,4-dihydroxyphenyl)methylamino]phenyl]-methylhydrazinylidene]-3-[methyl-[(Z)-2-(methylamino)ethenyl]amino]propanoate |
| SMILES | CCOC(=O)/C(CN(C)/C=C\NC)=N\N(C)c1ccc(NCc2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C23H31N5O4/c1-5-32-23(31)21(16-27(3)13-12-24-2)26-28(4)19-9-7-18(8-10-19)25-15-17-6-11-20(29)14-22(17)30/h6-14,24-25,29-30H,5,15-16H2,1-4H3/b13-12-,26-21- |
| InChIKey | FSOMGQHHYWPLIX-KOXAENSYSA-N |
| XLogP | 2.69 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|